| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(S)-(+)-2-(DibenzylaMino)-1-propanol CAS:60479-65-4 Purity:99% Package:1G
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-66113011 17714375163 |
| Email: |
cfzhang@aikonchem.com |
| Products Intro: |
Product Name:(S)-2-(Dibenzylamino)propan-1-ol CAS:60479-65-4 Purity:95% Package:1g;5g;10g
|
|
| | (S)-(+)-2-(DIBENZYLAMINO)-1-PROPANOL Basic information |
| | (S)-(+)-2-(DIBENZYLAMINO)-1-PROPANOL Chemical Properties |
| Melting point | 46-48 °C (lit.) | | Boiling point | 142-148 °C/0.1 mmHg (lit.) | | density | 0.9889 (rough estimate) | | refractive index | 1.5400 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | Optical Rotation | [α]20/D +90°, c = 1 in chloroform | | InChI | 1S/C17H21NO/c1-15(14-19)18(12-16-8-4-2-5-9-16)13-17-10-6-3-7-11-17/h2-11,15,19H,12-14H2,1H3/t15-/m0/s1 | | InChIKey | IEEFFKXJADVWJO-HNNXBMFYSA-N | | SMILES | C[C@@H](CO)N(Cc1ccccc1)Cc2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(+)-2-(DIBENZYLAMINO)-1-PROPANOL Usage And Synthesis |
| Uses | Building block for the synthesis of HIV protease inhibitors. |
| | (S)-(+)-2-(DIBENZYLAMINO)-1-PROPANOL Preparation Products And Raw materials |
|