2'- and 3'-O-(4-Benzoylbenzoyl)-adenosine 5'-triphosphate triethylammonium salt manufacturers
|
| | 2'- and 3'-O-(4-Benzoylbenzoyl)-adenosine 5'-triphosphate triethylammonium salt Basic information |
| Product Name: | 2'- and 3'-O-(4-Benzoylbenzoyl)-adenosine 5'-triphosphate triethylammonium salt | | Synonyms: | 2'-3'-O-(4-benzoylbenzoyl)adenosine*5'-triphospha;2'-3'-O-(4-BENZOYLBENZOYL)ADENOSINE5'-TR IPHOSPHATE;BENZOYLBENZOIC ADENOSINE 5'-TRIPHOSPHATE;2'(3')-O-(4-Benzoylbenzoyl)adenosine-5'-triphosphatetri(triethylammonium)salt;2'(3')-o-(4-benzoylbenzoyl)adeno;Adenosine 5'-(tetrahydrogen triphosphate) 3'-(4-benzoylbenzoate) compd. with N,N-diethylethanamine;2'(3')-o-(4-benzoylbenzoyl)adenosine 5'-triphosphate triethylammonium salt;benzoylbenzoyl-atp | | CAS: | 112898-15-4 | | MF: | C24H24N5O15P3.C6H15N | | MW: | 816.58 | | EINECS: | | | Product Categories: | | | Mol File: | 112898-15-4.mol |  |
| | 2'- and 3'-O-(4-Benzoylbenzoyl)-adenosine 5'-triphosphate triethylammonium salt Chemical Properties |
| storage temp. | -20°C | | solubility | ≤14 mg/ml in DMSO | | form | solid | | color | white to off-white | | biological source | synthetic (organic) | | Water Solubility | Soluble in water (supplied pre-dissolved at a concentration of 5mM) | | InChIKey | HVOVBTNCGADRTH-WBLDMZOZSA-N | | SMILES | N1(C=NC2C(N)=NC=NC1=2)[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](OC(=O)C2=CC=C(C(=O)C3=CC=CC=C3)C=C2)[C@H]1O.N(CC)(CC)CC |&1:10,12,27,45,r| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2'- and 3'-O-(4-Benzoylbenzoyl)-adenosine 5'-triphosphate triethylammonium salt Usage And Synthesis |
| Uses | 2′(3′)-O-(4-Benzoylbenzoyl)adenosine 5′-triphosphate triethylammonium salt has been used as a P2X4 receptor agonist in rat kidney sections, type I diabetes induced rats and astrocyteneuron coculture. It has also been used as a synthetic ATP analog in isotonic E3 medium. | | General Description | 2′(3′)-O-(4-Benzoylbenzoyl)adenosine 5′-triphosphate is a photoreactive analog of ATP. | | Biological Activity | Prototypic P2X 7 receptor agonist that exhibits 5 - 10 fold greater potency than ATP (EC 50 = 0.7 μ M in HEK 293 cells). Exhibits partial agonist activity at P2X 1 (pEC 50 = 8.7) and P2Y 1 receptors and can be used as a photoaffinity label for ATPase. | | Biochem/physiol Actions | 2′(3′)-O-(4-Benzoylbenzoyl)adenosine 5′-triphosphate triethylammonium salt is a selective purinergic receptor (P2X) agonist. It is more potent than ATP at homodimeric P2X7 receptors. It also effectively activates P2X1, P2X2, and P2X3 receptors. Useful as a photoaffinity label for proteins and enzymes that bind ATP. | | storage | -20°C |
| | 2'- and 3'-O-(4-Benzoylbenzoyl)-adenosine 5'-triphosphate triethylammonium salt Preparation Products And Raw materials |
|