3-Cyanoquinoline manufacturers
- 3-Cyanoquinoline
-
- $1.10
-
2025-11-18
- CAS:34846-64-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
- 3-Cyanoquinoline
-
- $1.00
-
2021-08-25
- CAS:34846-64-5
- Min. Order: 1KG
- Purity: 99
- Supply Ability: 100MT
|
| | 3-Cyanoquinoline Basic information |
| | 3-Cyanoquinoline Chemical Properties |
| Melting point | 108-110 °C (lit.) | | Boiling point | 323.7±15.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 1.72±0.11(Predicted) | | form | powder | | color | White to off-white | | InChI | InChI=1S/C10H6N2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8/h1-5,7H | | InChIKey | QZZYYBQGTSGDPP-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C=C(C#N)C=1 | | CAS DataBase Reference | 34846-64-5(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Quinolinecarbonitrile(34846-64-5) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Cyanoquinoline Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3-Quinolinecarbonitrile was used as a template for EGFR inhibitors. |
| | 3-Cyanoquinoline Preparation Products And Raw materials |
|