| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Bis(1H,1H,2H,2H-perfluorooctyl)tin oxide Basic information |
| Product Name: | Bis(1H,1H,2H,2H-perfluorooctyl)tin oxide | | Synonyms: | BIS(3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL)TIN OXIDE;Stannane, oxobis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-;Bis(1H,1H,2H,2H-perfluorooctyl)tin oxide | | CAS: | 324063-66-3 | | MF: | C16H8F26OSn | | MW: | 828.9 | | EINECS: | | | Product Categories: | | | Mol File: | 324063-66-3.mol |  |
| | Bis(1H,1H,2H,2H-perfluorooctyl)tin oxide Chemical Properties |
| Melting point | 92-94 °C | | InChI | 1S/2C8H4F13.O.Sn/c2*1-2-3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;;/h2*1-2H2;; | | InChIKey | VCPJPAQHWCNPKF-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Sn](=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Bis((perfluorohexyl)ethyl)stannanone (324063-66-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-53 | | Safety Statements | 61 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Bis(1H,1H,2H,2H-perfluorooctyl)tin oxide Usage And Synthesis |
| | Bis(1H,1H,2H,2H-perfluorooctyl)tin oxide Preparation Products And Raw materials |
| Raw materials | Stannane, dibromobis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)--->Sodium hydroxide-->Water |
|