| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Bis(1H,1H,2H,2H,3H,3H-perfluorononyl) azodicarboxylate Basic information |
| Product Name: | Bis(1H,1H,2H,2H,3H,3H-perfluorononyl) azodicarboxylate | | Synonyms: | BIS(4,4,5,5,6,6,7,7,8,8,9,9,9-TRIDECAFLUORONONYL) AZODICARBOXYLATE;1,2-Diazenedicarboxylic acid, 1,2-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl) ester;Bis(1H,1H,2H,2H,3H,3H-perfluorononyl) azodicarboxylate | | CAS: | 462996-01-6 | | MF: | C20H12F26N2O4 | | MW: | 838.28 | | EINECS: | | | Product Categories: | | | Mol File: | 462996-01-6.mol |  |
| | Bis(1H,1H,2H,2H,3H,3H-perfluorononyl) azodicarboxylate Chemical Properties |
| Melting point | 56-60 °C | | storage temp. | -20°C | | form | flakes | | InChIKey | DYPPJKHPJMGHKW-QJGAVIKSSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCOC(=O)\N=N\C(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl) diazene-1,2-dicarboxylate (462996-01-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis(1H,1H,2H,2H,3H,3H-perfluorononyl) azodicarboxylate Usage And Synthesis |
| | Bis(1H,1H,2H,2H,3H,3H-perfluorononyl) azodicarboxylate Preparation Products And Raw materials |
|