- (-)-Epigallocatechin
-
- $5.00/ KG
-
2026-04-10
- CAS:970-74-1
- Min. Order: 0.10000000149011612KG
- Purity: 99% hplc
- Supply Ability: 5000kg
|
| | (-)-Epigallocatechin Basic information |
| Product Name: | (-)-Epigallocatechin | | Synonyms: | (-)-epigallocatechol;3,3’,4’,5,5’,7-flavanhexol;5,7-triol,3,4-dihydro-2-(3,4,5-trihydroxyphenyl)-2h-1-benzopyran-(2r-cis;antiscurvyfactorc(sub2);epigallocatechol;EPIGALLOCATECHIN, (-)- SNAP-N-SHOOT 0.1mg/mL(P);professional supplier Epigallocatechin 970-74-1;(-)-EGC, ≥98%(HPLC) | | CAS: | 970-74-1 | | MF: | C15H14O7 | | MW: | 306.27 | | EINECS: | 619-254-4 | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Aromatics;Heterocycles;Inhibitors;Pharmaceutical Raw Materials;Catechins & Tannins | | Mol File: | 970-74-1.mol |  |
| | (-)-Epigallocatechin Chemical Properties |
| Melting point | 208-210°C | | alpha | -50 º (c=0.04, EtOH) | | Boiling point | 685.6±55.0 °C(Predicted) | | density | 1.695±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 9.02±0.15(Predicted) | | form | Solid | | color | White to Light Beige | | biological source | green tea | | λmax | 278nm(MeOH)(lit.) | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | 1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15-/m1/s1 | | InChIKey | XMOCLSLCDHWDHP-IUODEOHRSA-N | | SMILES | O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c3cc(O)c(O)c(O)c3 | | LogP | -0.100 (est) | | CAS DataBase Reference | 970-74-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | KB5100000 | | F | 3-10 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | (-)-Epigallocatechin Usage And Synthesis |
| Chemical Properties | white powder | | Uses | antineoplastic | | Uses | A natural constituent of green tea. It is an antioxidant and a potential cancer chemopreventive agent. An epimer of (-)-Gallocatechin (G188990). | | Uses | A natural product from green tea that induces apoptosis | | Definition | ChEBI: (-)-epigallocatechin is a flavan-3,3',4',5,5',7-hexol having (2R,3R)-configuration. It has a role as an antioxidant, a plant metabolite and a food component. It is a flavan-3,3',4',5,5',7-hexol and a catechin. It is an enantiomer of a (+)-epigallocatechin. | | General Description | ()-Epigallocatechin (EGC) belongs to the tea catechins group of polyphenols. | | Biochem/physiol Actions | Green tea polyphenol. Anticancer agent. Lower antioxidant activity than EGCG. |
| | (-)-Epigallocatechin Preparation Products And Raw materials |
|