|
|
| | n-Butylamine-d11 DCl Basic information |
| Product Name: | n-Butylamine-d11 DCl | | Synonyms: | N-BUTYLAMINE-D11 DEUTERIUM CHLORIDE;n-Butylamine-d11 deuteriochloride
;n-Butylamine-d11 deuteriochloride;n-Butylamine-d11 DCl | | CAS: | 347841-81-0 | | MF: | C4H12ClN | | MW: | 109.6 | | EINECS: | | | Product Categories: | | | Mol File: | 347841-81-0.mol |  |
| | n-Butylamine-d11 DCl Chemical Properties |
| Melting point | 215-216°C | | form | Solid | | color | White to off-white | | InChI | 1S/C4H11N.ClH/c1-2-3-4-5;/h2-5H2,1H3;1H/i1D3,2D2,3D2,4D2;/hD3 | | InChIKey | ICXXXLGATNSZAV-CCVMVDGLSA-N | | SMILES | Cl[2H].[2H]N([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Skin Corr. 1B STOT SE 3 |
| | n-Butylamine-d11 DCl Usage And Synthesis |
| Uses | n-Butylamine-d11 DCl (CAS# 347841-81-0) is a useful isotopically labeled research compound. |
| | n-Butylamine-d11 DCl Preparation Products And Raw materials |
|