| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Cyclopentane-1,1-diacetic acid Basic information |
| Product Name: | Cyclopentane-1,1-diacetic acid | | Synonyms: | BETA,BETA-TETRAMETHYLENEGLUTARIC ACID;1,1-CYCLOPENTANEDIACETIC ACID;Cyclopentane-1,1-diacetic acid;1,1-CYCLOPENTANEDIACETIC ACID, 98+%;3,3-Tetramethyleneglutaric acid, 98+%;1,2_cyclopentanediaceticacid;1,2-cyclopentanediaceticacid;tetramethyleneglutaricacid | | CAS: | 16713-66-9 | | MF: | C9H14O4 | | MW: | 186.21 | | EINECS: | 240-761-8 | | Product Categories: | Building Blocks;C9;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks | | Mol File: | 16713-66-9.mol |  |
| | Cyclopentane-1,1-diacetic acid Chemical Properties |
| Melting point | 180-181 °C(lit.) | | Boiling point | 240.69°C (rough estimate) | | density | 1.1006 (rough estimate) | | refractive index | 1.4129 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | within almost transparency in Methanol | | pka | 4.42±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 2099523 | | InChI | InChI=1S/C9H14O4/c10-7(11)5-9(6-8(12)13)3-1-2-4-9/h1-6H2,(H,10,11)(H,12,13) | | InChIKey | FWPVKDFOUXHOKQ-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)(CC(O)=O)CCCC1 | | CAS DataBase Reference | 16713-66-9(CAS DataBase Reference) |
| | Cyclopentane-1,1-diacetic acid Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER |
| | Cyclopentane-1,1-diacetic acid Preparation Products And Raw materials |
|