|
|
| | 4-(Phenylthio)benzaldehyde Basic information | | Application |
| Product Name: | 4-(Phenylthio)benzaldehyde | | Synonyms: | ART-CHEM-BB B022078;4-PHENYLSULFANYL-BENZALDEHYDE;AKOS B022078;p-(phenylthio)benzaldehyde;4-(Phenythio)benzaldehde;Benzaldehyde, 4-(phenylthio)-;4-(Phenylthio)benzaldehyde | | CAS: | 1208-88-4 | | MF: | C13H10OS | | MW: | 214.28 | | EINECS: | 214-905-5 | | Product Categories: | | | Mol File: | 1208-88-4.mol |  |
| | 4-(Phenylthio)benzaldehyde Chemical Properties |
| Melting point | 53-54 °C | | Boiling point | 136-138 °C(Press: 0.1 Torr) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C13H10OS/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h1-10H | | InChIKey | VDNBWBPUFMZCEW-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(SC2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 1208-88-4(CAS DataBase Reference) |
| | 4-(Phenylthio)benzaldehyde Usage And Synthesis |
| Application | 4-Phenylenylbenzaldehyde can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production processes. |
| | 4-(Phenylthio)benzaldehyde Preparation Products And Raw materials |
|