|
|
| | 2,7-Naphthalenedisulfonyl chloride Basic information |
| | 2,7-Naphthalenedisulfonyl chloride Chemical Properties |
| Melting point | 156-157 °C(Solv: benzene (71-43-2)) | | Boiling point | 499.4±25.0 °C(Predicted) | | density | 1.651±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C10H6Cl2O4S2/c11-17(13,14)9-3-1-7-2-4-10(18(12,15)16)6-8(7)5-9/h1-6H | | InChIKey | FJKUZZHKEDNPDN-UHFFFAOYSA-N | | SMILES | ClS(=O)(=O)c1ccc2ccc(cc2c1)S(Cl)(=O)=O |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2,7-Naphthalenedisulfonyl chloride Usage And Synthesis |
| | 2,7-Naphthalenedisulfonyl chloride Preparation Products And Raw materials |
|