5-O-Methylvisamminol manufacturers
|
| | 5-O-Methylvisamminol Basic information |
| Product Name: | 5-O-Methylvisamminol | | Synonyms: | (S)-2,3-Dihydro-2-(1-hydroxy-1-methylethyl)-4-methoxy-7-methyl-5H-furo[3,2-g][1]benzopyran-5-one;(S)-(+)-5-O-methylvisamminol;5H-Furo[3,2-g][1]benzopyran-5-one, 2,3-dihydro-2-(1-hydroxy-1-methylethyl)-4-methoxy-7-methyl-, (2S)-;inhibit,Inhibitor,5 O Methylvisamminol,5OMethylvisamminol;(S)-2-(2-Hydroxypropan-2-yl)-4-methoxy-7-methyl-2H-furo[3,2-g]chromen-5(3H)-one;R5-O-Methylvisamminol;5-O-Methylvisamminol-RM;5-O-Methylvisamminol, 10 mM in DMSO | | CAS: | 80681-42-1 | | MF: | C16H18O5 | | MW: | 290.31 | | EINECS: | | | Product Categories: | | | Mol File: | 80681-42-1.mol |  |
| | 5-O-Methylvisamminol Chemical Properties |
| Melting point | 133-135℃ | | Boiling point | 480.6±45.0 °C(Predicted) | | density | 1.281±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 14.25±0.29(Predicted) | | color | Light yellow to yellow | | Major Application | food and beverages | | InChI | 1S/C16H18O5/c1-8-5-10(17)14-12(20-8)7-11-9(15(14)19-4)6-13(21-11)16(2,3)18/h5,7,13,18H,6H2,1-4H3/t13-/m0/s1 | | InChIKey | DGFLRNOCLJGHLY-ZDUSSCGKSA-N | | SMILES | [o]1c2c([c](cc1C)=O)c(c3c(c2)O[C@@H](C3)C(O)(C)C)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-O-Methylvisamminol Usage And Synthesis |
| Uses | food and beverages | | Definition | ChEBI: 5-O-Methylvisamminol is an oxacycle and an organic heterotricyclic compound. |
| | 5-O-Methylvisamminol Preparation Products And Raw materials |
|