|
|
| | bis(DL-methioninato-N,O)copper Basic information | | Uses |
| Product Name: | bis(DL-methioninato-N,O)copper | | Synonyms: | Copper DL-Methionine;bis(DL-methioninato-N,O)copper;Nsc314278;Copamin;DL-Methionine copper complex;DL-Methionine copper(2+) salt;Methionine copper salt;Copper Methionine | | CAS: | 15170-74-8 | | MF: | C10H18CuN2O4S2 | | MW: | 357.93 | | EINECS: | 239-224-0 | | Product Categories: | | | Mol File: | 15170-74-8.mol |  |
| | bis(DL-methioninato-N,O)copper Chemical Properties |
| InChI | InChI=1S/2C5H10NO2S.Cu/c2*1-9-3-2-4(6)5(7)8;/h2*4,6H,2-3H2,1H3,(H,7,8);/q2*-1;+4/p-2 | | InChIKey | IXGMCGAVSAIOAF-UHFFFAOYSA-L | | SMILES | C(C1C([O-][Cu+2]2([O-]C(=O)C(CCSC)N2)N1)=O)CSC |
| | bis(DL-methioninato-N,O)copper Usage And Synthesis |
| Uses | Copper methionine is a novel feed additive—an amino acid chelate. This product exhibits good stability and will not destroy various types of vitamins or catalyze the oxidation of fats in feed. Using this product is beneficial for improving the quality of premixed and complete feed products. |
| | bis(DL-methioninato-N,O)copper Preparation Products And Raw materials |
|