|
|
| | diethyl N-[4-(methylamino)benzoyl]-L-glutamate Basic information |
| Product Name: | diethyl N-[4-(methylamino)benzoyl]-L-glutamate | | Synonyms: | diethyl N-[4-(methylamino)benzoyl]-L-glutamate;DIETHYL-N-(PARA-METHYLAMINOBENZOYL)-L-GLUTAMATE;(2S)-2-[[4-(Methylamino)benzoyl]amino]glutaric acid diethyl ester;N-(4-MethylaMinobenzoyl)-L-lutaMic acid diethylester;L-GLUTAMIC ACID,N-[4-(METHYLAMINO)BENZOYL]-, 1,5-DIETHYL ESTER;N-(p-Methylaminobenzoyl)glutamic acid diethyl ester;Diethyl N-(p-N-methylaminobenzoyl)glutamate;diethyl (2S)-2-[[4-(methylamino)benzoyl]amino]pentanedioate | | CAS: | 2378-95-2 | | MF: | C17H24N2O5 | | MW: | 336.38 | | EINECS: | 219-161-5 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 2378-95-2.mol | ![diethyl N-[4-(methylamino)benzoyl]-L-glutamate Structure](CAS/GIF/2378-95-2.gif) |
| | diethyl N-[4-(methylamino)benzoyl]-L-glutamate Chemical Properties |
| Melting point | 88-89 °C | | Boiling point | 518.3±50.0 °C(Predicted) | | density | 1.165±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Aqueous Acid (Slightly), DMSO (Slightly), Methanol (Sparingly) | | form | Solid | | pka | 14.01±0.46(Predicted) | | color | Off-White to Pale Brown | | Optical Rotation | -21.1°(C=0.01g/mI, 1N HCL, 20°C, 589nm) | | Stability: | Hygroscopic | | InChI | InChI=1S/C17H24N2O5/c1-4-23-15(20)11-10-14(17(22)24-5-2)19-16(21)12-6-8-13(18-3)9-7-12/h6-9,14,18H,4-5,10-11H2,1-3H3,(H,19,21)/t14-/m0/s1 | | InChIKey | WBYNXAAEBPJETG-AWEZNQCLSA-N | | SMILES | C(OCC)(=O)[C@H](CCC(OCC)=O)NC(=O)C1=CC=C(NC)C=C1 | | EPA Substance Registry System | L-Glutamic acid, N-[4-(methylamino)benzoyl]-, diethyl ester (2378-95-2) |
| | diethyl N-[4-(methylamino)benzoyl]-L-glutamate Usage And Synthesis |
| Uses | 1,5-Diethyl N-[4-(methylamino)benzoyl]-L-glutamate is a useful research chemical compound used in the synthesis of furo[2,3-d]pyrimidines as novel antifolates. |
| | diethyl N-[4-(methylamino)benzoyl]-L-glutamate Preparation Products And Raw materials |
|