|
|
| | Sodium1-ethoxy-1,3-dioxopropan-2-ide Basic information |
| Product Name: | Sodium1-ethoxy-1,3-dioxopropan-2-ide | | Synonyms: | sodium ethyl 3-oxidoacrylate;3-Sodiooxypropenoic acid ethyl ester;Nsc243613;3-Sodiumoxypropenoic acid ethyl ester;Ethyl Hydroxymethyleneacetate, Sodium Salt;3-ethoxy-3-oxoprop-1-en-1-olate sodium salt;Sodium 3-Ethoxy-3-Oxo-1-Propen-1-Olate;Sodium1-ethoxy-1,3-dioxopropan-2-ide | | CAS: | 58986-28-0 | | MF: | C5H7NaO3 | | MW: | 138.1 | | EINECS: | 261-544-4 | | Product Categories: | | | Mol File: | 58986-28-0.mol |  |
| | Sodium1-ethoxy-1,3-dioxopropan-2-ide Chemical Properties |
| storage temp. | -20°C, stored under nitrogen, away from moisture | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H7O3.Na/c1-2-8-5(7)3-4-6;/h3-4H,2H2,1H3;/q-1;+1 | | InChIKey | FUVIDZPLBWWKLD-UHFFFAOYSA-N | | SMILES | C(=O)(OCC)[CH-]C=O.[Na+] |
| | Sodium1-ethoxy-1,3-dioxopropan-2-ide Usage And Synthesis |
| | Sodium1-ethoxy-1,3-dioxopropan-2-ide Preparation Products And Raw materials |
|