|
|
| | N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate Basic information |
| Product Name: | N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate | | Synonyms: | S-(1-OXIDO-2-PYRIDYL)-N,N,N',N'-TETRAMETHYLTHIURONIUM-PF6;N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuron;S-(1-Oxido-2-pyridyl)-N,N,N',N'-tetramethylthiuron;HOTT N,N,N'',N''-TETRAMETHYL-S-(1-OXIDO-2-PYRIDYL)THIURONIUM HEXAFLUOROPHOSPHATE;HOTT;N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate;S-(1-Oxido-2-pyridyl)-thio-N,N,N,N-tetramethyluronium hexafluorophosphate;S-(2-Pyridyl)-N,N,Nμ,Nμ-tetramethylthiuronium N-oxide hexafluorophosphate, N,N,Nμ,Nμ-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate | | CAS: | 212333-72-7 | | MF: | C10H16N3OS.F6P | | MW: | 371.28 | | EINECS: | 805-907-2 | | Product Categories: | Coupling Reagent | | Mol File: | 212333-72-7.mol |  |
| | N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate Chemical Properties |
| Melting point | 120-125 °C | | storage temp. | -20°C | | solubility | acetonitrile, CH2Cl2, THF (moderate solubility) | | form | Powder | | color | White to yellow | | Sensitive | Moisture Sensitive | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H16N3OS.F6P/c1-11(2)10(12(3)4)15-9-7-5-6-8-13(9)14;1-7(2,3,4,5)6/h5-8H,1-4H3;/q+1;-1 | | InChIKey | UCOGEMMJHLHOAW-UHFFFAOYSA-N | | SMILES | [S+](C1=CC=CC=[N+]1[O-])=C(N(C)C)N(C)C.[P-](F)(F)(F)(F)(F)F | | CAS DataBase Reference | 212333-72-7(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids |
| | N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate Usage And Synthesis |
| Chemical Properties | N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate is white to pale brown crystalline powder | | Uses | N,N,N’,N’-Tetramethyl-S-(1-oxido-2-pyridyl)thiouronium Hexafluorophosphate is a reagent used in the preparation of hindered Barton esters from hindered carboxylic acid precursors. N,N,N’,N’-Tetramethyl-S-(1-oxido-2-pyridyl)thiouronium Hexafluorophosphate is also used as a coupling reagents for peptide bond formations and amidation reactions. | | Uses | N,N,N’N’Tetramethyl-S-(1-oxido-2-pyridyl)thiouronium Hexafluorophosphate is a reagent used in the preparation of hindered Barton esters from hindered carboxylic acid precursors. N,N,N’N’Tetramethy
l-S-(1-oxido-2-pyridyl)thiouronium Hexafluorophosphate is also used as a coupling reagents for peptide bond formations and amidation reactions. | | reaction suitability | reaction type: Coupling Reactions | | Synthesis |
S-(1-Oxido-2-pyridinyl)-1,1,3,3-tetramethylthiouronium Hexafluorophosphate (HOTT) can be prepared by slowly adding Et3N to a dry CH2Cl2 solution of 2-mercaptopyridine-N-oxide and tetramethylchloroformamidinium hexafluorophosphate. After the removal of CH2Cl2 from the reaction mixture, the resulting solid mass is pulverized, washed with CHCl3, and then filtered to give a white solid of sufficient purity to be used in subsequent reactions.
| | Precautions | It is advised to protect the solid from prolonged exposure to light since 2- mercaptopyridine N-oxide and related compounds can be light-sensitive.
|
| | N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate Preparation Products And Raw materials |
|