|
|
| | RAC CARPROFEN-D3 Basic information |
| | RAC CARPROFEN-D3 Chemical Properties |
| Melting point | 186-1880C | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | Major Application | forensics and toxicology
pharmaceutical (small molecule)
veterinary | | InChI | 1S/C15H12ClNO2/c1-8(15(18)19)9-2-4-11-12-7-10(16)3-5-13(12)17-14(11)6-9/h2-8,17H,1H3,(H,18,19)/i1D3 | | InChIKey | PUXBGTOOZJQSKH-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])C(C(O)=O)c1ccc2c(c1)[nH]c3ccc(Cl)cc23 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | RAC CARPROFEN-D3 Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | Labelled Carprofen (C184350). Anti-inflammatory. |
| | RAC CARPROFEN-D3 Preparation Products And Raw materials |
|