| Company Name: |
RuiKeXin Gold |
| Tel: |
19938953786 |
| Email: |
810766265@qq.com |
|
| | 1H-Benzimidazole-6-carboxylic acid, 2-[[6-[(4-cyano-2-fluorophenyl)methoxy]-3',6'-dihydro[2,4'-bipyridin]-1'(2'H)-yl]methyl]-1-[(2S)-2-oxetanylmethyl]- Basic information |
| | 1H-Benzimidazole-6-carboxylic acid, 2-[[6-[(4-cyano-2-fluorophenyl)methoxy]-3',6'-dihydro[2,4'-bipyridin]-1'(2'H)-yl]methyl]-1-[(2S)-2-oxetanylmethyl]- Chemical Properties |
| Boiling point | 803.9±65.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | pka | 3.38±0.30(Predicted) | | form | Solid | | color | White to light yellow | | InChIKey | HLOTYODPTNOHMJ-DEOSSOPVSA-N | | SMILES | C1(CN2CCC(C3=NC(OCC4=CC=C(C#N)C=C4F)=CC=C3)=CC2)N(C[C@@H]2CCO2)C2=CC(C(O)=O)=CC=C2N=1 |
| | 1H-Benzimidazole-6-carboxylic acid, 2-[[6-[(4-cyano-2-fluorophenyl)methoxy]-3',6'-dihydro[2,4'-bipyridin]-1'(2'H)-yl]methyl]-1-[(2S)-2-oxetanylmethyl]- Usage And Synthesis |
| Uses | GLP-1R agonist 3 is a potent agonist of GLP-1R. GLP-1R agonist 3 is a thickened imidazole derivative compound. Glucagon-like peptide-1 (GLP-1) is an intestinal hypoglycemic hormone secreted by L-cells in the lower gastrointestinal tract. GLP-1R agonist 3 has the potential for the research of diabetes (extracted from patent WO2021197464A1, compound 1)[1]. | | References | [1] Fanglong Yang, et al. Thickened imidazole derivatives, methods of their preparation and their application in medicine. Patent WO2021197464A1. |
| | 1H-Benzimidazole-6-carboxylic acid, 2-[[6-[(4-cyano-2-fluorophenyl)methoxy]-3',6'-dihydro[2,4'-bipyridin]-1'(2'H)-yl]methyl]-1-[(2S)-2-oxetanylmethyl]- Preparation Products And Raw materials |
|