| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Hafnium trifluoromethanesulfonate Basic information |
| Product Name: | Hafnium trifluoromethanesulfonate | | Synonyms: | TRIFLUOROMETHANESULFONIC ACID HAFNIUM(4) SALT;TRIFLUOROMETHANESULFONIC ACID HAFNIUM(IV) SALT;HAFNIUM(IV) TRIFLATE;HAFNIUM (IV) TRIFLUOROMETHANESULPHONATE;HAFNIUM TRIFLUOROMETHANESULFONATE HYDRAT E;hafnium(iv) trifluoromethanesulfonate hydrate;Hafnium trifluoromethanesulphonate;HafniuM trifluoroMethanesulfonate,98% Hf(CF3SO3)4 | | CAS: | 161337-67-3 | | MF: | CHF3HfO3S | | MW: | 328.56 | | EINECS: | | | Product Categories: | | | Mol File: | 161337-67-3.mol |  |
| | Hafnium trifluoromethanesulfonate Chemical Properties |
| Melting point | >350 °C(lit.) | | Fp | None | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | solubility | Soluble in methyl cyanide, dicholomethane, dichloroethane, nitromethane, dioxane, terahydrofuran and toluene. | | form | powder to crystal | | color | White to Light yellow | | Sensitive | Hygroscopic | | Exposure limits | ACGIH: TWA 0.5 mg/m3
NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 | | InChI | 1S/4CHF3O3S.Hf/c4*2-1(3,4)8(5,6)7;/h4*(H,5,6,7);/q;;;;+4/p-4 | | InChIKey | BQYMOILRPDTPPJ-UHFFFAOYSA-J | | SMILES | FC(F)(F)S(=O)(=O)O[Hf](OS(=O)(=O)C(F)(F)F)(OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F | | CAS DataBase Reference | 161337-67-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1759 8/PG III | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Hafnium trifluoromethanesulfonate Usage And Synthesis |
| Uses | Hafnium trifluoromethanesulfonate is a recyclable catalyst for the mononitration of o-nitrotoluene. It serves as a catalyst for homogeneous methoxycarbonylation and hydrocarboxylation reactions of phenylacetylene. It is also used as a reactant for direct Friedel-Crafts reactions of chromene hemiacetals, aminomethylation reactions under Lewis acidic conditions and prins-type cyclization reactions. It is also involved in the direct polycondensation of lactic acid. Further, it is used in cationic benzylation reactions, chemoselective thioacetalization and transthioacetalization of carbonyl compounds. | | Uses | Catalyst for:
- Homogeneous methoxycarbonylation and hydrocarboxylation reactions of phenylacetylene
- Direct Friedel-Crafts reactions of chromene hemiacetals
- Aminomethylation reactions under Lewis acidic conditions
- Prins-type cyclization reactions
- Direct polycondensation of lactic acid
- Cationic benzylation reactions
- Chemoselective thioacetalization and transthioacetalization of carbonyl compounds
| | reaction suitability | core: hafnium
reagent type: catalyst |
| | Hafnium trifluoromethanesulfonate Preparation Products And Raw materials |
|