S-Adenosyl-L-methionine iodide salt manufacturers
|
| | S-Adenosyl-L-methionine iodide salt Basic information |
| Product Name: | S-Adenosyl-L-methionine iodide salt | | Synonyms: | SAM-E IODIDE SALT;S-ADENOSYLMETHIONINE IODIDE;S-ADENOSYL METHIONINE IODIDE SALT;ADENOSYL-L-METHIONINE, S-IODIDE SALT;S-(5'-deoxy-5'-adenosyl)methionine iodide;S-(5'-Adenosyl)-L-methionine iodide;SAM iodide salt;SAM iodide salt;S-adenosylmethione | | CAS: | 3493-13-8 | | MF: | C15H23IN6O5S | | MW: | 526.35 | | EINECS: | 222-486-5 | | Product Categories: | Nucleic acids | | Mol File: | 3493-13-8.mol |  |
| | S-Adenosyl-L-methionine iodide salt Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 100 mg/mL | | form | powder | | color | white to off-white | | Water Solubility | H2O: 100mg/mL | | BRN | 4120787 | | InChIKey | XQMWYLXPEGFCFT-JKRVOTFBNA-N | | SMILES | N1(C=NC2C(N)=NC=NC1=2)[C@H]1[C@H](O)[C@H](O)[C@@H](C[S+](C)CC[C@H](N)C(=O)O)O1.[I-] |&1:10,11,13,15,21,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | F | 8-10-23 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | S-Adenosyl-L-methionine iodide salt Usage And Synthesis |
| Uses | S-(5′-Adenosyl)-L-methionine (SAM, AdoMet) is used as a primary methyl donor molecule in mammalian cell culture and the first step metabolite in methionine biosynthesis. | | Biochem/physiol Actions | Methyl donor; cofactor for enzyme-catalyzed methylations, including catechol O-methyltransferase (COMT) and DNA methyltransferases (DNMT). Although present in all cells, it is concentrated in liver where 85% of all methylation reactions occur. It is also involved in regulating liver function, growth, and response to injury. | | IC 50 | Human Endogenous Metabolite |
| | S-Adenosyl-L-methionine iodide salt Preparation Products And Raw materials |
|