|
|
| | Carbamic acid, [(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Basic information |
| Product Name: | Carbamic acid, [(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ester (9CI) | | Synonyms: | Carbamic acid, [(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ester (9CI);(R)-3-(Boc-aMino)cyclopentanone;tert-butyl N-[(1R)-3-oxocyclopentyl]carbamate;(R)-tert-Butyl (3-oxocyclopentyl)carbamate;-tert-Butyl (3-oxocyclopentyl);(R)-3-(Boc-amino)cyclopentanone - A11265;Carbamic acid, N-[(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ester;Carbamic acid,N-[(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ... | | CAS: | 225641-86-1 | | MF: | C10H17NO3 | | MW: | 199.25 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 225641-86-1.mol | ![Carbamic acid, [(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Structure](CAS/GIF/225641-86-1.gif) |
| | Carbamic acid, [(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Boiling point | 319.2±31.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.89±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-7-4-5-8(12)6-7/h7H,4-6H2,1-3H3,(H,11,13)/t7-/m1/s1 | | InChIKey | CLOXAWYNXXEWBT-SSDOTTSWSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCC(=O)C1 |
| | Carbamic acid, [(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| | Carbamic acid, [(1R)-3-oxocyclopentyl]-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|