| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3',4'-Dihydroxyflavone Basic information |
| Product Name: | 3',4'-Dihydroxyflavone | | Synonyms: | 4-HYDROXYFLAVONOL;3',4'-Dihydroxyflavone,97%;DIHYDROXYFLAVONE, 3',4'-(RG);DIHYDROXYFLAVONE, 3',4'-;2-(3,4-dihydroxyphenyl)chromen-4-one;2-(3,4-dihydroxyphenyl)chromone;2-(3,4-Dihydroxyphenyl)-4H-benzopyran-4-one;2-(3,4-dihydroxyphenyl)-1-benzopyran-4-one | | CAS: | 4143-64-0 | | MF: | C15H10O4 | | MW: | 254.24 | | EINECS: | | | Product Categories: | Di-substituted Flavones | | Mol File: | 4143-64-0.mol |  |
| | 3',4'-Dihydroxyflavone Chemical Properties |
| Melting point | 251-253°C | | Boiling point | 482.3±45.0 °C(Predicted) | | density | 1.443 | | storage temp. | 15-25°C | | solubility | DMF: 15 mg/ml; DMSO: 10 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 0.16 mg/ml | | pka | 8.29±0.18(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | λmax | 343nm(EtOH)(lit.) | | BRN | 212540 | | Major Application | food and beverages pharmaceutical | | InChI | 1S/C15H10O4/c16-11-6-5-9(7-13(11)18)15-8-12(17)10-3-1-2-4-14(10)19-15/h1-8,16,18H | | InChIKey | SRNPMQHYWVKBAV-UHFFFAOYSA-N | | SMILES | O1c2c(cccc2)C(=O)C=C1c3cc(c(cc3)O)O | | LogP | 3.080 (est) | | CAS DataBase Reference | 4143-64-0(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | HS Code | 2932.99.7000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 3',4'-Dihydroxyflavone Usage And Synthesis |
| Uses | 3,4''-Dihydroxyflavone is used in methods and compounds involving flavonols. |
| | 3',4'-Dihydroxyflavone Preparation Products And Raw materials |
|