|
|
| | (R)-3-Amino-3-(2-chloro-phenyl)-propionic acid Basic information |
| Product Name: | (R)-3-Amino-3-(2-chloro-phenyl)-propionic acid | | Synonyms: | (R)-3-(2-CHLOROPHENYL)-BETA-ALANINE;D-beta-(2-chlorophenyl)alanine;(3R)-3-amino-3-(2-chlorophenyl)propanoic acid;Benzenepropanoic acid, .beta.-amino-2-chloro-, (.beta.R)-;D-3-Amino-3-(2-chloro)propanoic acid;REF DUPL: D-beta-(2-chlorophenyl)alanine;Benzenepropanoic acid, β-amino-2-chloro-, (βR)-;(R)-3-Amino-3-(2-chloro-phenyl)-propionic acid USP/EP/BP | | CAS: | 740794-79-0 | | MF: | C9H10ClNO2 | | MW: | 199.63 | | EINECS: | | | Product Categories: | | | Mol File: | 740794-79-0.mol |  |
| | (R)-3-Amino-3-(2-chloro-phenyl)-propionic acid Chemical Properties |
| Melting point | 235-239 °C (sublm)(Solv: water (7732-18-5); acetone (67-64-1)) | | Boiling point | 336.5±32.0 °C(Predicted) | | density | 1.333±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 3.62±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C9H10ClNO2/c10-7-4-2-1-3-6(7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/s3 | | InChIKey | NXXFYRJVRISCCP-SBYBRXNCNA-N | | SMILES | C1(C=CC=CC=1Cl)[C@H](N)CC(=O)O |&1:7,r| |
| | (R)-3-Amino-3-(2-chloro-phenyl)-propionic acid Usage And Synthesis |
| | (R)-3-Amino-3-(2-chloro-phenyl)-propionic acid Preparation Products And Raw materials |
|