|
|
| | 1,4,5,8-TETRAHYDROXYANTHRAQUINONE Basic information | | Uses |
| Product Name: | 1,4,5,8-TETRAHYDROXYANTHRAQUINONE | | Synonyms: | 1,4,5,8-TETRAHYDROXYANTHRACENE-9,10-DIONE;1,4,5,8-TETRAHYDROXYANTHRAQUINONE;RARECHEM AQ BD AN29;1,4,5,8-Leucotetraoxyanthraquinone;1,4,5,8-Ltoa;1,4,5,8-tetrahydroxy-10-anthracenedione;1,4,5,8-Tetrahydroxy-9,10-anthacendione;1,4,5,8-Tetrahydroxyanthrachinon | | CAS: | 81-60-7 | | MF: | C14H8O6 | | MW: | 272.21 | | EINECS: | 201-365-0 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 81-60-7.mol |  |
| | 1,4,5,8-TETRAHYDROXYANTHRAQUINONE Chemical Properties |
| Melting point | >274.85°C | | Boiling point | 375.27°C (rough estimate) | | density | 1.4292 (rough estimate) | | refractive index | 1.5230 (estimate) | | pka | 6.45±0.20(Predicted) | | InChI | InChI=1S/C14H8O6/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4,15-18H | | InChIKey | SOGCSKLTQHBFLP-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C(O)=CC=C3O)=C(O)C=C1 | | CAS DataBase Reference | 81-60-7(CAS DataBase Reference) |
| | 1,4,5,8-TETRAHYDROXYANTHRAQUINONE Usage And Synthesis |
| Uses | 1,4,5,8-Tetrahydroxyanthra-9,10-quinone is used in preparing electrode material of Lithium ion batteries. Also, used in production of alkali metal and alkali-ion batteries with high volumetric and gravimetric energy densities. | | Definition | ChEBI: 1,4,5,8-tetrahydroxyanthraquinone is a tetrahydroxyanthraquinone. | | Synthesis | 1,4,5,8-Tetrahydroxyanthraquinone is prepared
from 4,8-diamino-1,5-dihydroxyanthraquinone-
2,6-disulfonic acid by treatment with a
mixture of sodium dithionite–sodium hydroxide
in aqueous medium . |
| | 1,4,5,8-TETRAHYDROXYANTHRAQUINONE Preparation Products And Raw materials |
|