- Quinalizarin
-
- $0.00 / 50mg
-
2026-04-14
- CAS:81-61-8
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 1,2,5,8-TETRAHYDROXYANTHRAQUINONE Basic information |
| Product Name: | 1,2,5,8-TETRAHYDROXYANTHRAQUINONE | | Synonyms: | CI 58500;CI NO 58500;LABOTEST-BB LT00129956;ALIZARIN CYANINE 3R;ALIZARIN BORDEAUX;Quinidine cupric sulfate solution;1,2,5,8-tetrahydroxyanthracene-9,10-dione;QUINALIZARIN GR | | CAS: | 81-61-8 | | MF: | C14H8O6 | | MW: | 272.21 | | EINECS: | 201-366-6 | | Product Categories: | Miscellaneous | | Mol File: | 81-61-8.mol |  |
| | 1,2,5,8-TETRAHYDROXYANTHRAQUINONE Chemical Properties |
| Melting point | ≥300 °C | | Boiling point | 375.27°C (rough estimate) | | density | 1.4292 (rough estimate) | | refractive index | 1.5230 (estimate) | | storage temp. | room temp | | form | powder | | Colour Index | 58500 | | color | red | | Water Solubility | 2.586mg/L(25 ºC) | | BRN | 1889617 | | InChI | 1S/C14H8O6/c15-6-3-4-7(16)11-10(6)12(18)5-1-2-8(17)13(19)9(5)14(11)20/h1-4,15-17,19H | | InChIKey | VBHKTXLEJZIDJF-UHFFFAOYSA-N | | SMILES | Oc1ccc2C(=O)c3c(O)ccc(O)c3C(=O)c2c1O | | CAS DataBase Reference | 81-61-8(CAS DataBase Reference) | | EPA Substance Registry System | 9,10-Anthracenedione, 1,2,5,8-tetrahydroxy- (81-61-8) |
| Hazard Codes | Xn,N | | Risk Statements | 36/37/38-50-22 | | Safety Statements | 26-36-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | 1,2,5,8-TETRAHYDROXYANTHRAQUINONE Usage And Synthesis |
| Uses | 1,2,5,8-TETRAHYDROXYANTHRAQUINONE is Al salts dark red, cotton mordanted with Cr salts bluish-violet. No longer used as a dye, except occasionally in printing cotton. | | Preparation | Quinalizarin. 1,2-Dihydroxyanthracene-9,10-dione or 1,4-Dihydroxyanthracene-9,10-dione with great excess fuming sulfuric acid oxidation and hydrolysis. | | Definition | ChEBI: A tetrahydroxyanthraquinone having the four hydroxy groups at the 1-, 2-, 5- and 8-positions. | | Biochem/physiol Actions | Quinalizarin is a potent (IC50 = 110 nM), ATP-competitive, and highly selective (IC50 >1μM against CK1 and 72 other kinases) casein Kinase II (CK2) inhibitor. | | Properties and Applications | violet (chromium), dark red light purple (aluminum). Soluble in ethanol. In concentrated sulfuric acid for blue purple, dilution after dark red precipitation.
|
Standard
|
Ironing Fastness
|
Light Fastness
|
Fulling
|
Persperation Fastness
|
Soaping
|
Water
|
|
Alkali
|
Acid
|
|
ISO
|
|
6
|
4-5
|
|
5
|
4-5
|
|
| | Purification Methods | Crystallise the quinone from acetic acid or nitrobenzene. It can be sublimed in vacuo. The Cu salt forms red crystals. [Beilstein 8 H 549, 8 I 755, 8 II 584.] |
| | 1,2,5,8-TETRAHYDROXYANTHRAQUINONE Preparation Products And Raw materials |
|