2-Chloro-4-ethylpyridine manufacturers
- 2-Chloro-4-ethylpyridine
-
- $1.10 / 1g
-
2025-11-18
- CAS:40325-11-9
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 2-Chloro-4-ethylpyridine Basic information |
| | 2-Chloro-4-ethylpyridine Chemical Properties |
| Boiling point | 206.0±20.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform, Ether, Ethyl Acetate | | form | Oil | | pka | 0.85±0.10(Predicted) | | color | Colorless | | InChI | InChI=1S/C7H8ClN/c1-2-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3 | | InChIKey | WCZPTMALUBBXRK-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(CC)=C1 |
| | 2-Chloro-4-ethylpyridine Usage And Synthesis |
| Chemical Properties | Colorless Liquid | | Uses | 2-Chloro-4-ethylpyridine (cas# 40325-11-9) is a compound useful in organic synthesis. |
| | 2-Chloro-4-ethylpyridine Preparation Products And Raw materials |
|