Thiophene-3,4-diol manufacturers
- Thiophene-3,4-diol
-
- $1.00
-
2026-02-02
- CAS:14282-59-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 50tons
|
| | Thiophene-3,4-diol Basic information |
| Product Name: | Thiophene-3,4-diol | | Synonyms: | Thiophene-3,4-diol;3,4-Thiophenediol;Thiophene-3,4-diol ISO 9001:2015 REACH;T922613 Thiophene-3,4-diol,98% | | CAS: | 14282-59-8 | | MF: | C4H4O2S | | MW: | 116.14 | | EINECS: | | | Product Categories: | | | Mol File: | 14282-59-8.mol |  |
| | Thiophene-3,4-diol Chemical Properties |
| Melting point | 90-91.5 °C(Solv: benzene (71-43-2); ethyl acetate (141-78-6)) | | Boiling point | 255.4±20.0 °C(Predicted) | | density | 1.532±0.06 g/cm3(Predicted) | | pka | 9.21±0.10(Predicted) | | InChI | InChI=1S/C4H4O2S/c5-3-1-7-2-4(3)6/h1-2,5-6H | | InChIKey | MPKQTNAUFAZSIJ-UHFFFAOYSA-N | | SMILES | C1SC=C(O)C=1O |
| | Thiophene-3,4-diol Usage And Synthesis |
| | Thiophene-3,4-diol Preparation Products And Raw materials |
|