| Company Name: |
Hangzhou J&H Chemical Co., Ltd.
|
| Tel: |
0571-87396432 |
| Email: |
sales@jhechem.com |
| Products Intro: |
Product Name:1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl-
CAS:2459671-87-3
Purity:98% HPLC Package:50KG;10KG;5KG;1KG
|
| Company Name: |
Sholon Chem-Tech Co.,Ltd
|
| Tel: |
+86-19901505185 +86-15312550623 |
| Email: |
info@sholonchem.com |
| Products Intro: |
Product Name:1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl-
CAS:2459671-87-3
Purity:99.50% Package:1kg;25kg
|
| Company Name: |
Shengyan (Shanghai) New Materials Co. , Ltd.
|
| Tel: |
021-37596312 13585706261 |
| Email: |
feng@syanchem.com |
| Products Intro: |
Product Name:1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl-
CAS:2459671-87-3
Purity:99% HPLC Package:100g 1kg 1okg 50kg
|
| Company Name: |
Zhejiang Hongwu Technology Co., Ltd.
|
| Tel: |
18255593606 19705058148 |
| Email: |
wlb@hwoled.com |
| Products Intro: |
Product Name:1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl-
CAS:2459671-87-3
Purity:98%HPLC Package:10g;100g;1kg
|
|
| | 1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl- Basic information |
| Product Name: | 1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl- | | Synonyms: | 1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl- | | CAS: | 2459671-87-3 | | MF: | C31H18ClN3O | | MW: | 483.95 | | EINECS: | | | Product Categories: | | | Mol File: | 2459671-87-3.mol | ![1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl- Structure](CAS/20210305/GIF/2459671-87-3.gif) |
| | 1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl- Chemical Properties |
| Boiling point | 742.5±70.0 °C(Predicted) | | density | 1.336±0.06 g/cm3(Predicted) | | pka | -0.01±0.10(Predicted) | | InChI | InChI=1S/C31H18ClN3O/c32-25-16-15-23(27-24-17-21-13-7-8-14-22(21)18-26(24)36-28(25)27)31-34-29(19-9-3-1-4-10-19)33-30(35-31)20-11-5-2-6-12-20/h1-18H | | InChIKey | FMBHVXDEHUDCMW-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=CC=C2)N=C(C2=CC=CC=C2)N=C1C1=C2C3=CC4C(=CC=CC=4)C=C3OC2=C(Cl)C=C1 |
| | 1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl- Usage And Synthesis |
| Uses | 1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl- is an OLED intermediate. |
| | 1,3,5-Triazine, 2-(4-chlorobenzo[b]naphtho[2,3-d]furan-1-yl)-4,6-diphenyl- Preparation Products And Raw materials |
|