Dihydrodicyclopentadienyl acrylate manufacturers
|
| | Dihydrodicyclopentadienyl acrylate Basic information |
| Product Name: | Dihydrodicyclopentadienyl acrylate | | Synonyms: | 2-Propenoicacid,hexahydro-4,7-methano-1H-indenylester;ACRYLICACID,DICYCLOPENTENYLESTER;2-Propenoic acid,3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5(or 6)-yl ester;Dihydrodicychlopentadienyl Acrylate;Hexahydro-4,7-methano-1H-indenylacrylat;Dicyclopentenyl acrylate(DCPA);CHLUMICRYI DCPA Monomer;hexahydro-4,7-methano-1H-indenyl acrylate | | CAS: | 12542-30-2 | | MF: | C13H16O2 | | MW: | 204.26 | | EINECS: | 235-697-2 | | Product Categories: | | | Mol File: | 12542-30-2.mol |  |
| | Dihydrodicyclopentadienyl acrylate Chemical Properties |
| Melting point | -36°C | | Boiling point | 77°C 0,5mm | | density | 1,07 g/cm3 | | vapor pressure | 0.88Pa at 20℃ | | Fp | 126°C | | Water Solubility | 40mg/L at 25℃ | | InChI | InChI=1/C13H16O2/c1-2-12(14)15-11-6-5-10-8-3-4-9(7-8)13(10)11/h2-4,8-11,13H,1,5-7H2/t8-,9+,10,11,13/s3 | | InChIKey | VTUJVKUOIFFTME-WMUZLINNNA-N | | SMILES | C12C(OC(=O)C=C)CCC1[C@]1([H])C[C@@]2([H])C=C1 |&1:10,13,r| | | LogP | 4.3 at 23℃ | | EPA Substance Registry System | 2-Propenoic acid, 3a,4,7,7a,?,?-hexahydro-4,7-methano-1H-indenyl ester (12542-30-2) |
| | Dihydrodicyclopentadienyl acrylate Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | Dihydrodicyclopentadienyl acrylate Preparation Products And Raw materials |
|