| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 5'-DEOXYURIDINE Basic information |
| Product Name: | 5'-DEOXYURIDINE | | Synonyms: | 5'-Deoxyuridne;Uridine, 5'-deoxy-;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione;1-((2R,3R,4S,5R)-3,4-dihydroxy-5-methyltetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione;5'-DEOXYURIDINE;1-((2R,3R,4S,5R)-3,4-dihydroxy-5-methyltetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione - [D92420] | | CAS: | 15958-99-3 | | MF: | C9H12N2O5 | | MW: | 228.2 | | EINECS: | | | Product Categories: | Pharmaceutical Raw Materials;Bases & Related Reagents;Carbohydrates & Derivatives;Heterocycles;Nucleotides | | Mol File: | 15958-99-3.mol |  |
| | 5'-DEOXYURIDINE Chemical Properties |
| density | 1.550±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.39±0.10(Predicted) | | form | Solid | | color | White to Light Yellow | | InChI | InChI=1S/C9H12N2O5/c1-4-6(13)7(14)8(16-4)11-3-2-5(12)10-9(11)15/h2-4,6-8,13-14H,1H3,(H,10,12,15)/t4-,6-,7-,8-/m1/s1 | | InChIKey | WUBAOANSQGKRHF-XVFCMESISA-N | | SMILES | C[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@H](O)[C@@H]1O |
| | 5'-DEOXYURIDINE Usage And Synthesis |
| Uses | 5'-DEOXYURIDINE is a uridine derivative used as a therapeutic agent for treating allergy, cancer, infection and autoimmune disease | | Uses | 5’-Deoxyuridine is a uridine derivative used as a therapeutic agent for treating allergy, cancer, infection and autoimmune disease. |
| | 5'-DEOXYURIDINE Preparation Products And Raw materials |
|