| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2′,3′-O-Isopropylideneuridine Basic information |
| Product Name: | 2′,3′-O-Isopropylideneuridine | | Synonyms: | Uridine 2',3'-acetonide;Uridine, 2',3'-O-(1-methylethylidene)-;Uridine, 2',3'-O-isopropylidene-;2',3'-ISOPROPYLIDENEURIDENE;2,3-ISOPROPYLIDENE URIDINE;2',3'-IPU;2',3'-O-Isopropylidene-D-uridine;2'-O,3'-O-Isopropylideneuridine | | CAS: | 362-43-6 | | MF: | C12H16N2O6 | | MW: | 284.27 | | EINECS: | 206-647-7 | | Product Categories: | API intermediates;Bases & Related Reagents;Nucleotides;Biochemicals and Reagents;Nucleoside Analogs;Nucleosides, Nucleotides, Oligonucleotides | | Mol File: | 362-43-6.mol |  |
| | 2′,3′-O-Isopropylideneuridine Chemical Properties |
| Melting point | 163-166 °C | | Boiling point | 426.76°C (rough estimate) | | density | 1.2932 (rough estimate) | | refractive index | 1.5460 (estimate) | | storage temp. | -20°C | | solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) | | form | Fine Crystalline Powder or Needles | | pka | 9.25±0.10(Predicted) | | color | White | | biological source | synthetic (organic) | | Optical Rotation | -19°(C=0.01g/ml MEOH) | | Water Solubility | water: 50mg/mL, clear to very slightly hazy, colorless to light yellow | | BRN | 32671 | | InChI | InChI=1S/C12H16N2O6/c1-12(2)19-8-6(5-15)18-10(9(8)20-12)14-4-3-7(16)13-11(14)17/h3-4,6,8-10,15H,5H2,1-2H3,(H,13,16,17)/t6-,8-,9-,10-/m1/s1 | | InChIKey | GFDUSNQQMOENLR-PEBGCTIMSA-N | | SMILES | OC[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@@H]2OC(O[C@H]12)(C)C | | CAS DataBase Reference | 362-43-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 2′,3′-O-Isopropylideneuridine Usage And Synthesis |
| Description | 2',3'-Isopropylideneuridine has been shown to inhibit binding of pestivirus inhibitors by monoclonal antibodies. 2',3'-Isopropylideneuridine was also found to inhibit the replication of human immunodeficiency virus (HIV) in tissue culture by binding to the viral RNA polymerase and inhibiting its activity, preventing viral replication. | | Chemical Properties | White Needle-Like Crystals | | Uses | 2′,3′-O-Isopropylideneuridine is used in the chemical synthesis of N-benzoylated uridine derivatives and N3-substituted 2′,3′-O-isopropylideneuridines with central nervous system (CNS) depressant activity. | | Uses | 2',3'-O-Isopropylideneuridine can be used as a useful precursor for the preparation of nucleic acids. |
| | 2′,3′-O-Isopropylideneuridine Preparation Products And Raw materials |
|