2,4-dihydroxy-Butanoic acid manufacturers
|
| | 2,4-dihydroxy-Butanoic acid Basic information |
| Product Name: | 2,4-dihydroxy-Butanoic acid | | Synonyms: | 2,4-dihydroxy-Butanoic acid;Butanoic acid, 2,4-dihydroxy-;2,4-Dihydroxy-butyric acid calcium salt;(+/-)-2，4-Dihydroxybutyric acid lithium salt;(±)-2,4-Dihydroxybutyric acid lithium salt;2,4-dihydroxybutanoic acid | | CAS: | 1518-62-3 | | MF: | C4H8O4 | | MW: | 120.1 | | EINECS: | | | Product Categories: | | | Mol File: | 1518-62-3.mol |  |
| | 2,4-dihydroxy-Butanoic acid Chemical Properties |
| Melting point | 167-169 °C | | Boiling point | 412.0±30.0 °C(Predicted) | | density | 1.420±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.71±0.10(Predicted) | | Major Application | clinical testing | | InChI | InChI=1S/C4H8O4/c5-2-1-3(6)4(7)8/h3,5-6H,1-2H2,(H,7,8) | | InChIKey | UFYGCFHQAXXBCF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(O)CCO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2,4-dihydroxy-Butanoic acid Usage And Synthesis |
| Uses | (S)-2,4-Dihydroxybutanoic Acid Lithium Salt is a building block used in synthesis of various compounds. | | Definition | ChEBI: A omega-hydroxy fatty acid that is butyric acid substituted by hydroxy groups at positions 2 and 4 respectively. | | Biological Activity | Various cases of succinic semialdehyde dehydrogenase deficiency have shown consistently increased amounts of this metabolite, while 2,4-dihydroxybutanoic acid is usually absent in normal human urine extracts or in only trace constituents in neonates. |
| | 2,4-dihydroxy-Butanoic acid Preparation Products And Raw materials |
|