Bis(4-nitrophenyl)phosphoric acid sodium salt manufacturers
|
| | Bis(4-nitrophenyl)phosphoric acid sodium salt Basic information |
| | Bis(4-nitrophenyl)phosphoric acid sodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | water: 20 mg/mL, clear to very slightly hazy | | form | powder to crystal | | color | White to Yellow | | Water Solubility | water: 20mg/mL, clear to very slightly hazy | | InChI | 1S/C12H9N2O8P.Na.H/c15-13(16)9-1-5-11(6-2-9)21-23(19,20)22-12-7-3-10(4-8-12)14(17)18;;/h1-8H,(H,19,20);; | | InChIKey | NXXNKMXTNUUECE-UHFFFAOYSA-N | | SMILES | [Na].OP(=O)(Oc1ccc(cc1)N(=O)=O)Oc2ccc(cc2)N(=O)=O | | CAS DataBase Reference | 4043-96-3(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 2920.90.2000 | | Storage Class | 11 - Combustible Solids |
| | Bis(4-nitrophenyl)phosphoric acid sodium salt Usage And Synthesis |
| Uses | Bis(p-nitrophenyl) phosphate sodium salt has been used as a substrate for the estimation of phosphodiesterase (PDE) activity. It has also been used as a substrate in PDE inhibition assay. |
| | Bis(4-nitrophenyl)phosphoric acid sodium salt Preparation Products And Raw materials |
|