|
|
| | 4-Aminophenyl phosphate monosodium salt hydrate Basic information |
| Product Name: | 4-Aminophenyl phosphate monosodium salt hydrate | | Synonyms: | 4-amino-phenol-1-(dihydrogen phosphate) monosodium salt;Sodium 4-aminophenyl hydrogenphosphate;4-Aminophenyl phosphate monosodium salt, Alkaline phosphatase substrate;4-Aminophenyl phosphate monosodium salt hydrate | | CAS: | 108084-47-5 | | MF: | C6H9NNaO5P | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | 108084-47-5.mol |  |
| | 4-Aminophenyl phosphate monosodium salt hydrate Chemical Properties |
| storage temp. | -20°C | | solubility | Soluble in methanol | | form | Off-white to light gray crystalline solid. | | InChI | 1S/C6H8NO4P.Na.H2O/c7-5-1-3-6(4-2-5)11-12(8,9)10;;/h1-4H,7H2,(H2,8,9,10);;1H2/q;+1;/p-1 | | InChIKey | XWJZNVNMMLRLJR-UHFFFAOYSA-M | | SMILES | NC1=CC=C(OP(O)(O[Na])=O)C=C1 |
| WGK Germany | WGK 3 | | HS Code | 2922290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Aminophenyl phosphate monosodium salt hydrate Usage And Synthesis |
| Uses | 4-Aminophenyl phosphate monosodium salt hydrate may be used as a reagent for the sensitive detection and estimation of tumor necrosis factor-alpha (TNF-α) in undiluted serum developed via the process of electrochemical enzyme-linked immunosorbent assay (ELISA). |
| | 4-Aminophenyl phosphate monosodium salt hydrate Preparation Products And Raw materials |
|