|
|
| | 2-Bromo-5-methyl-1,3,4-thiadiazole Basic information |
| | 2-Bromo-5-methyl-1,3,4-thiadiazole Chemical Properties |
| Melting point | 105-110 °C | | Boiling point | 242.0±23.0 °C(Predicted) | | density | 1.830±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | -0.90±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C3H3BrN2S/c1-2-5-6-3(4)7-2/h1H3 | | InChIKey | NSMKWTGDPQHTDH-UHFFFAOYSA-N | | SMILES | S1C(C)=NN=C1Br |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-5-methyl-1,3,4-thiadiazole Usage And Synthesis |
| | 2-Bromo-5-methyl-1,3,4-thiadiazole Preparation Products And Raw materials |
|