|
|
| | CYCLO(-LEU-GLY) Basic information |
| Product Name: | CYCLO(-LEU-GLY) | | Synonyms: | C(LEU-GLY);CYCLO(GLY-L-LEU);CYCLO(-LEU-GLY);CYCLO(L-LEU-GLY);MORPHINE TOLERANCE PEPTIDE;MORPHIN, TOLERANCE PEPTIDE;2,5-Piperazinedione,3-(2-methylpropyl)-, (3S)-;Cyclo(Gly-Leu-) | | CAS: | 5845-67-0 | | MF: | C8H14N2O2 | | MW: | 170.21 | | EINECS: | | | Product Categories: | | | Mol File: | 5845-67-0.mol |  |
| | CYCLO(-LEU-GLY) Chemical Properties |
| Melting point | 255℃ | | Boiling point | 442.9±38.0 °C(Predicted) | | density | 1.047 | | storage temp. | -15°C | | solubility | DMSO (Sparingly), Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 13.22±0.40(Predicted) | | color | White to Off-White | | InChI | 1S/C8H14N2O2/c1-5(2)3-6-8(12)9-4-7(11)10-6/h5-6H,3-4H2,1-2H3,(H,9,12)(H,10,11)/t6-/m0/s1 | | InChIKey | VQFHWKRNHGHZTK-LURJTMIESA-N | | SMILES | CC(C)C[C@@H]1NC(=O)CNC1=O |
| Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | CYCLO(-LEU-GLY) Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Cyclo(Leu-Gly) is an antimicrobial compound produced by Latobacillus plantarum. | | in vivo | Cyclo(glycyl-L-leucyl) (8 mg/kg; s.c.) given 24h after apomorphine (APO) attenuates the DA receptor supersensitivity caused by acute high dose APO (5 mg/kg; s.c.)[1]. | Animal Model: | Male Swiss-Webster mice, 20-25g[1] | | Dosage: | 8 mg/kg | | Administration: | SC; single dose given 24h after apomorphine (APO) | | Result: | Attenuated the DA receptor supersensitivity caused by acute high dose APO (5 mg/kg; s.c.).
|
| | IC 50 | Dopamine Receptor |
| | CYCLO(-LEU-GLY) Preparation Products And Raw materials |
|