|
|
| | N-methyl-N-formylhydrazine Basic information |
| Product Name: | N-methyl-N-formylhydrazine | | Synonyms: | N-methyl-N-formylhydrazine;N-METHYL-N-FORMYLHYDRAZIDE;1-Methylformhydrazid;1-Formyl-1-methylhydrazine;1-Methyl-1-formylhydrazine;MFH;N-Methylformhydrazide;1-Methyl-1-formylhydrazid | | CAS: | 758-17-8 | | MF: | C2H6N2O | | MW: | 74.08 | | EINECS: | | | Product Categories: | | | Mol File: | 758-17-8.mol |  |
| | N-methyl-N-formylhydrazine Chemical Properties |
| Melting point | 219-222 °C(Solv: ethanol (64-17-5)) | | Boiling point | 131.34°C (rough estimate) | | density | 1.0968 (rough estimate) | | refractive index | 1.4368 (estimate) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Oil | | pka | 3.12±0.10(Predicted) | | color | Colourless to Light Yellow | | Stability: | Volatile | | InChI | InChI=1S/C2H6N2O/c1-4(3)2-5/h2H,3H2,1H3 | | InChIKey | RSFOTOSOKJMMCB-UHFFFAOYSA-N | | SMILES | N(C=O)(C)N |
| | N-methyl-N-formylhydrazine Usage And Synthesis |
| Uses | N-Methyl-N-formylhydrazine is a substituent used in the synthesis of Marbofloxacin (M197000), a fluorinated quinolone antibacterial agent. | | Safety Profile | Suspected carcinogen
with experimental carcinogenic data. Poison
by ingestion route. Mutation data reported.
When heated to decomposition it emits
toxic fumes of NOx. See also HYDRAZINE. |
| | N-methyl-N-formylhydrazine Preparation Products And Raw materials |
|