| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
cannabielsoin manufacturers
- cannabielsoin
-
- $7.00
-
2025-03-21
- CAS:52025-76-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000KGS
|
| | cannabielsoin Basic information |
| Product Name: | cannabielsoin | | Synonyms: | cannabielsoin;(5aS,6S,9R)-5aβ,6,7,8,9,9aβ-Hexahydro-6α-methyl-9β-(1-methylethenyl)-3-pentyl-1,6-dibenzofurandiol;Cannabielsoin A;Cannabielsoin I;1,6-Dibenzofurandiol, 5a,6,7,8,9,9a-hexahydro-6-methyl-9-(1-methylethenyl)-3-pentyl-, (5aS,6S,9R,9aR)-;Cannabielsoin (CBE) solution;Cannabielsoin (CRM) | | CAS: | 52025-76-0 | | MF: | C21H30O3 | | MW: | 330.46 | | EINECS: | | | Product Categories: | | | Mol File: | 52025-76-0.mol |  |
| | cannabielsoin Chemical Properties |
| Boiling point | 426.5±45.0 °C(Predicted) | | density | 1.089±0.06 g/cm3(Predicted) | | storage temp. | -10 to -25°C | | solubility | DMF: 50 mg/ml; DMSO: 60 mg/ml; DMSO:PBS (pH 7.2) (1:3): 0.25 mg; Ethanol: 35 mg/ml | | pka | 9.78±0.60(Predicted) | | InChI | 1S/C21H30O3/c1-5-6-7-8-14-11-16(22)19-17(12-14)24-20-18(19)15(13(2)3)9-10-21(20,4)23/h11-12,15,18,20,22-23H,2,5-10H2,1,3-4H3/t15-,18+,20-,21-/m0/s1 | | InChIKey | RBEAVAMWZAJWOI-MTOHEIAKSA-N | | SMILES | O1[C@H]2[C@H]([C@@H](CC[C@@]2(O)C)C(=C)C)c3c1cc(cc3O)CCCCC |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | cannabielsoin Usage And Synthesis |
| Description | Cannabielsoin (CRM) (Item No. 36661) is a certified reference material categorized as a phytocannabinoid metabolite.1,2 Cannabielsoin is a metabolite of cannabidiol (CBD; Item Nos. ISO60156 | 90080). This product is intended for research and forensic applications.WARNING This product is not for human or veterinary use. |
| | cannabielsoin Preparation Products And Raw materials |
|