1,6-Bis(2,3-epoxypropoxy)naphthalene manufacturers
|
| | 1,6-Bis(2,3-epoxypropoxy)naphthalene Basic information |
| Product Name: | 1,6-Bis(2,3-epoxypropoxy)naphthalene | | Synonyms: | Oxirane,2,2'-[1,6-naphthalenediylbis(oxyMethylene)]bis-;2,2'-((naphthalene-1,6-diylbis(oxy))bis(methylene))bis(oxirane);2,2'-[1,6-naphthalenediylbis (oxymethylene)]bis-Oxirane;1,6-Bis(2,3-epoxypropan-1-yloxy)naphthalene;1,6-Bis(glycidyloxy)naphthalene;1,6-Bis(oxiranylmethoxy)naphthalene;1,6-Naphthalenediylbis(glycidyl ether);2-[[5-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxymethyl]oxirane | | CAS: | 27610-48-6 | | MF: | C16H16O4 | | MW: | 272.3 | | EINECS: | 429-960-2 | | Product Categories: | | | Mol File: | 27610-48-6.mol |  |
| | 1,6-Bis(2,3-epoxypropoxy)naphthalene Chemical Properties |
| Boiling point | 455.5±15.0 °C(Predicted) | | density | 1.283±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | Water Solubility | 32.8mg/L at 20℃ | | InChI | InChI=1S/C16H16O4/c1-2-11-6-12(17-7-13-8-18-13)4-5-15(11)16(3-1)20-10-14-9-19-14/h1-6,13-14H,7-10H2 | | InChIKey | MEVBAGCIOOTPLF-UHFFFAOYSA-N | | SMILES | C1(OCC2CO2)=C2C(C=C(OCC3CO3)C=C2)=CC=C1 | | LogP | 2.3 at 20℃ | | EPA Substance Registry System | Oxirane, 2,2'-[1,6-naphthalenediylbis(oxymethylene)]bis- (27610-48-6) |
| | 1,6-Bis(2,3-epoxypropoxy)naphthalene Usage And Synthesis |
| | 1,6-Bis(2,3-epoxypropoxy)naphthalene Preparation Products And Raw materials |
|