|
|
| | 1,6-Dihydroxynaphthalene Basic information |
| | 1,6-Dihydroxynaphthalene Chemical Properties |
| Melting point | 130-133 °C (lit.) | | Boiling point | 246.06°C (rough estimate) | | density | 1.0924 (rough estimate) | | refractive index | 1.5418 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | very faint turbidity in Methanol | | form | Powder or Crystalline Powder | | pka | 9.26±0.40(Predicted) | | color | White to brown | | BRN | 1939032 | | InChI | InChI=1S/C10H8O2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-6,11-12H | | InChIKey | FZZQNEVOYIYFPF-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C=C(O)C=C2)=CC=C1 | | CAS DataBase Reference | 575-44-0(CAS DataBase Reference) | | NIST Chemistry Reference | 1,6-Naphthalenediol(575-44-0) | | EPA Substance Registry System | 1,6-Naphthalenediol (575-44-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | QJ4743333 | | TSCA | TSCA listed | | HS Code | 29072990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,6-Dihydroxynaphthalene Usage And Synthesis |
| Chemical Properties | Beige powder | | Definition | ChEBI: Naphthalene-1,6-diol is a naphthalenediol. | | Synthesis | 1,6-Naphthalenediol [575-44-0], mp 138℃, is synthesized by caustic fusion of naphthalene1,6-disulfonic acid at 330 C. It couples with diazotized anilines to form disazo and trisazo derivatives. | | Purification Methods | Crystallise it from *benzene or *benzene/EtOH after treatment with charcoal. [Beilstein 6 IV 6557.] |
| | 1,6-Dihydroxynaphthalene Preparation Products And Raw materials |
|