|
|
| | Bis(4-mercaptophenyl) ether Basic information |
| Product Name: | Bis(4-mercaptophenyl) ether | | Synonyms: | 4,4'-oxybisBenzenethiol;4,4'-Dimercaptodiphenyl ether;4-(4-sulfanylphenoxy)benzenethiol;Benzenethiol, 4,4'-oxybis-;4,4’-Oxydibenzenethiol;4-(4-SULFANYLPHENOXY)PHENYL HYDROSULFIDE;25g、100g、500g、1kg;Di(4-mercaptophenyl) ether | | CAS: | 17527-79-6 | | MF: | C12H10OS2 | | MW: | 234.34 | | EINECS: | | | Product Categories: | | | Mol File: | 17527-79-6.mol |  |
| | Bis(4-mercaptophenyl) ether Chemical Properties |
| Melting point | 103-104 °C | | Boiling point | 362.0±27.0 °C(Predicted) | | density | 1.265±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 6.22±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H10OS2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,14-15H | | InChIKey | WREGWRFRXHKFGE-UHFFFAOYSA-N | | SMILES | O(C1=CC=C(S)C=C1)C1=CC=C(S)C=C1 |
| | Bis(4-mercaptophenyl) ether Usage And Synthesis |
| | Bis(4-mercaptophenyl) ether Preparation Products And Raw materials |
|