|
|
| | 4,4'-Bis(chlorosulfonyl)diphenyl ether Basic information |
| | 4,4'-Bis(chlorosulfonyl)diphenyl ether Chemical Properties |
| Melting point | 124-127°C | | Boiling point | 471.8±30.0 °C(Predicted) | | density | 1.573±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO, Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | Sensitive | Moisture Sensitive | | BRN | 2169540 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C12H8Cl2O5S2/c13-20(15,16)11-5-1-9(2-6-11)19-10-3-7-12(8-4-10)21(14,17)18/h1-8H | | InChIKey | HJKXLQIPODSWMB-UHFFFAOYSA-N | | SMILES | O(C1=CC=C(S(Cl)(=O)=O)C=C1)C1=CC=C(S(Cl)(=O)=O)C=C1 | | CAS DataBase Reference | 121-63-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonyl chloride, 4,4'-oxybis- (121-63-1) |
| | 4,4'-Bis(chlorosulfonyl)diphenyl ether Usage And Synthesis |
| Uses | 4,4'-Bis(chlorosulfonyl)diphenyl ether can be used in organic synthesis, pharmaceutical, also is a plasticizer. It Is agent intermediates of OBSH foaming. | | Uses | 4,4’-Oxydibenzenesulfonyl Chloride is useful as an intermediate for blowing agents for rubber or resin. | | Preparation | Preparation of 4,4'-bis(chlorosulphonyl)diphenyl ether: Slowly add chlorosulphuric acid (20 mL) to diphenyl ether (8.5 g). Stir the reaction mixture at room temperature for 2 h. Pour the mixture into 200 mL of ice-cold water. Collect the crude bis(chlorosulphonyl) diphenyl ether by filtration. Wash the white solid with water. Dry the solid under reduced pressure to afford the title compound, 4,4'-bis(chlorosulphonyl) diphenyl ether. |
| | 4,4'-Bis(chlorosulfonyl)diphenyl ether Preparation Products And Raw materials |
|