| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Triphenylcarbenium pentachlorostannate Basic information |
| Product Name: | Triphenylcarbenium pentachlorostannate | | Synonyms: | TRITYL PENTACHLOROSTANNATE;TRIPHENYLMETHYLPENTACHLOROSTANNATE;triphenyl-methyliupentachlorostannate(1-);triphenylcarbenium pentachlorostannane;TRIPHENYLCARBENIUM PENTACHLOROSTANNATE 98%;Triphenylcarbenium pentachlorostannate,98%;Tritylcarbonium chlorostannate(IV);Triphenylcarbenium pentachlorostannate | | CAS: | 15414-98-9 | | MF: | C19H15Cl5Sn | | MW: | 539.3 | | EINECS: | 239-426-9 | | Product Categories: | | | Mol File: | 15414-98-9.mol |  |
| | Triphenylcarbenium pentachlorostannate Chemical Properties |
| storage temp. | 0-6°C | | InChI | 1S/C19H15.5ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 | | InChIKey | LJHTYNWDYRJYIH-UHFFFAOYSA-I | | SMILES | Cl[Sn-](Cl)(Cl)(Cl)Cl.c1ccc(cc1)[C+](c2ccccc2)c3ccccc3 | | EPA Substance Registry System | Methylium, triphenyl-, pentachlorostannate(1-) (15414-98-9) |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29310099 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Corr. 1B |
| | Triphenylcarbenium pentachlorostannate Usage And Synthesis |
| Chemical Properties | YELLOW-ORANGE TO BROWN POWDER | | Uses | Triphenylcarbenium pentachlorostannate can be used:
- In the study of cationic polymerization reactions of 3,6-dibromo-9-(2,3-epoxypropyl)carbazole using the microcalorimetric technique.
- In the synthesis of diarylcyclohexanones, the key intermediates for the preparation of antiprotozoals.
- As an initiator in the photopolymerization of carbazolyl derived epoxy monomers.
|
| | Triphenylcarbenium pentachlorostannate Preparation Products And Raw materials |
|