|
|
| | SWERTIANIN (SWERTIAE) Basic information |
| Product Name: | SWERTIANIN (SWERTIAE) | | Synonyms: | Gentiachochianin;SWERTIANIN (SWERTIAE);1,2,8-Trihydroxy-6-methoxy-9H-xanthen-9-one;Swertianine;6-Methoxy-1,2,8-trihydroxyxanthen-9-one;9H-Xanthen-9-one, 1,2,8-trihydroxy-6-methoxy- (9ci);Brn 1351024;Nsc 289490 | | CAS: | 20882-75-1 | | MF: | C14H10O6 | | MW: | 274.23 | | EINECS: | | | Product Categories: | | | Mol File: | 20882-75-1.mol |  |
| | SWERTIANIN (SWERTIAE) Chemical Properties |
| Melting point | 243℃ | | density | 1.586 | | storage temp. | 2-8°C | | InChI | InChI=1S/C14H10O6/c1-19-6-4-8(16)11-10(5-6)20-9-3-2-7(15)13(17)12(9)14(11)18/h2-5,15-17H,1H3 | | InChIKey | BDBVOZGRVBXANN-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(OC)C=C2O)OC2=C1C(O)=C(O)C=C2 | | LogP | 1.350 (est) |
| | SWERTIANIN (SWERTIAE) Usage And Synthesis |
| Uses | Swertianine is a xanthone that may have some monoamine oxidase inhibitory activity. | | Definition | ChEBI: A member of the class of xanthones that is 9H-xanthen-9-one substituted by hydroxy groups at positions 1, 2 and 8 and a methoxy group at position 6. It has been isolated from various species of the genus Swertia and has be
n found to exhibit antioxidant activities. |
| | SWERTIANIN (SWERTIAE) Preparation Products And Raw materials |
|