| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid Basic information |
| | 4-Methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid Chemical Properties |
| Melting point | 221-226 °C (D) | | storage temp. | 2-8°C | | solubility | DMF: 10 mg/ml; DMSO: 15 mg/ml; DMSO:PBS(pH 7.2) (1:2): 0.3 mg/ml; Ethanol: 0.3 mg/ml | | form | A crystalline solid | | InChI | 1S/C10H8N2O2S/c1-6-8(10(13)14)15-9(12-6)7-4-2-3-5-11-7/h2-5H,1H3,(H,13,14) | | InChIKey | QFDHWPOPCNNAOI-UHFFFAOYSA-N | | SMILES | Cc1nc(sc1C(O)=O)-c2ccccn2 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-Methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid Usage And Synthesis |
| Description | 2-(2-pyridyl)-4-methyl-Thiazole-5-carboxylic acid is a synthetic intermediate useful for pharmaceutical synthesis. | | Uses | 2-(2-Pyridyl)-4-methyl-thiazole-5-carboxylic acid is a synthetic intermediate useful for pharmaceutical synthesis. |
| | 4-Methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|