| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:1-(Bromomethyl)benzene-2,3,4,5,6-d5 CAS:71258-22-5 Purity:97%, 98 atom % D Package:1g
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Benzyl-d5 BroMide CAS:71258-22-5 Package:250Mg,25Mg
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Benzyl-2,3,4,5,6-d5 BroMide CAS:71258-22-5 Remarks:CS-C-01620
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Benzyl-d5 Bromide CAS:71258-22-5 Package:250mg;1g Remarks:T36465
|
|
| | BENZYL-2,3,4,5,6-D5 BROMIDE Basic information |
| Product Name: | BENZYL-2,3,4,5,6-D5 BROMIDE | | Synonyms: | BENZYL-2,3,4,5,6-D5 BROMIDE;Benzyl-d5 BroMide;BENZYL BROMIDE(RING-D5, 98%);1-(Bromomethyl)benzene-2,3,4,5,6-d5;Benzyl bromide d5#;Phenylmethyl bromide-d5;Benzyl bromide (ring-D?, 98%) | | CAS: | 71258-22-5 | | MF: | C7H2BrD5 | | MW: | 176.07 | | EINECS: | | | Product Categories: | Intermediates, Isotope Labelled Compounds | | Mol File: | 71258-22-5.mol |  |
| | BENZYL-2,3,4,5,6-D5 BROMIDE Chemical Properties |
| solubility | Acetone (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | color | Colourless to Dark Orange | | InChI | InChI=1S/C7H7Br/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1D,2D,3D,4D,5D | | InChIKey | AGEZXYOZHKGVCM-RALIUCGRSA-N | | SMILES | C1(CBr)C([2H])=C(C([2H])=C([2H])C=1[2H])[2H] | | CAS Number Unlabeled | 71258-22-5 |
| | BENZYL-2,3,4,5,6-D5 BROMIDE Usage And Synthesis |
| Uses | BENZYL-2,3,4,5,6-D5 BROMIDE is a compound used in organic synthesis for the introduction of the benzyl protecting group for alcohols and carboxylic acids. |
| | BENZYL-2,3,4,5,6-D5 BROMIDE Preparation Products And Raw materials |
|