| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 4-Vinylsulfonylbenzoic acid Basic information | | Uses |
| | 4-Vinylsulfonylbenzoic acid Chemical Properties |
| storage temp. | 2-8°C | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C9H8O4S/c1-2-14(12,13)8-5-3-7(4-6-8)9(10)11/h2-6H,1H2,(H,10,11) | | InChIKey | XVNBCTUERGUCCX-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(S(C=C)(=O)=O)C=C1 |
| | 4-Vinylsulfonylbenzoic acid Usage And Synthesis |
| Uses | 4-Vinylsulfonylbenzoic acid is a carboxylic acid derivative and can be used as an intermediate in organic synthesis. |
| | 4-Vinylsulfonylbenzoic acid Preparation Products And Raw materials |
|