- Transfluthrin
-
- $50.00
-
2026-05-28
- CAS:118712-89-3
- Min. Order: 1KG
- Purity: 95
- Supply Ability: 1 ton
- Transfluthrin
-
-
2025-06-27
- CAS:118712-89-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | Transfluthrin Basic information | | Uses |
| Product Name: | Transfluthrin | | Synonyms: | TRANSFLUTHRIN;3-(2,2-dichloroethenyl)-2,2-dimethyl-cyclopropanecarboxylic acid (2,3,5,6-tetrafluorophenyl)methylester;2,3,5,6-tetrafluorobenzyl-(1r,s)-trans-3-(2,2-dichlorovinyl)-2, 2-dimethyl-cyclopropanecarboxylate;BAYGON;BAYOTHRIN;TRANSFUTHRIN PESTANAL, 250 MG;Transfluthrin [iso];Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (2,3,5,6-tetrafluorophenyl)methyl ester, (1R,3S)- | | CAS: | 118712-89-3 | | MF: | C15H12Cl2F4O2 | | MW: | 371.15 | | EINECS: | 405-060-5 | | Product Categories: | Alpha sort;Insecticides;Pesticides;PyrethroidsPesticides&Metabolites;Q-ZAlphabetic;TP - TZ | | Mol File: | 118712-89-3.mol |  |
| | Transfluthrin Chemical Properties |
| Melting point | 32 °C | | Boiling point | 135 °C(Press: 0.15 Torr) | | density | 1.492±0.06 g/cm3(Predicted) | | Fp | >35 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | Henry's Law Constant | 2.2×10-1 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture
environmental | | InChI | 1S/C15H12Cl2F4O2/c1-15(2)7(3-10(16)17)11(15)14(22)23-5-6-12(20)8(18)4-9(19)13(6)21/h3-4,7,11H,5H2,1-2H3/t7-,11+/m1/s1 | | InChIKey | DDVNRFNDOPPVQJ-HQJQHLMTSA-N | | SMILES | FC1=C(F)C=C(F)C(F)=C1COC([C@H]2C(C)(C)[C@@H]2C=C(Cl)Cl)=O | | CAS DataBase Reference | 118712-89-3(CAS DataBase Reference) | | EPA Substance Registry System | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (2,3,5,6-tetrafluorophenyl)methyl ester, (1R,3S)- (118712-89-3) |
| Hazard Codes | Xi;N,N,Xi | | Risk Statements | 38-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 | | WGK Germany | 2 | | HS Code | 29162090 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Skin Irrit. 2 |
| | Transfluthrin Usage And Synthesis |
| Uses | Transfluthrin is a fluorinated aromatic compound for proteomics research. | | Uses | Transfluthrin is a fluorinated aromatic compound for proteomics research. | | Production Methods | Transfluthrin is commercially synthesised by esterifying 2,3,5,6-tetrafluorobenzyl alcohol with (1R,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid. The production process begins with the preparation of the two key intermediates: tetrafluorobenzyl alcohol, which provides high volatility, and the cyclopropanecarboxylic acid derivative, which contributes insecticidal potency. These are coupled via esterification under controlled temperature and solvent conditions, typically using acid catalysts to yield the active ester compound. | | Definition | ChEBI: A carboxylic ester obtained by formal condensation of 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid and 2,3,5,6-tetrafluorobenzyl alcohol. | | Mechanism of action | Broad-spectrum, effects insects presynaptic voltage gate sodium channels in nerve membranesrapid causing knockdown. Sodium channel modulator. | | Pesticide Type | Insecticide |
| | Transfluthrin Preparation Products And Raw materials |
|