- 3-Fluoroanisole
-
- $10.00 / 1KG
-
2026-01-05
- CAS:456-49-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 3-Fluoroanisole
-
- $9.00 / 1KG
-
2025-09-25
- CAS:456-49-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 3-Fluoroanisole
-
- $100.00 / 1kg
-
2024-04-28
- CAS:456-49-5
- Min. Order: 1kg
- Purity: 99.93%
- Supply Ability: 1000kg per week
|
| | 3-Fluoroanisole Basic information |
| | 3-Fluoroanisole Chemical Properties |
| Melting point | -35°C | | Boiling point | 158 °C/743 mmHg (lit.) | | density | 1.104 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.488(lit.) | | Fp | 111 °F | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, Methanol | | form | Oil | | Specific Gravity | 1.104 | | color | Colourless | | BRN | 1858895 | | InChI | InChI=1S/C7H7FO/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3 | | InChIKey | MFJNOXOAIFNSBX-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(OC)=C1 | | CAS DataBase Reference | 456-49-5(CAS DataBase Reference) | | NIST Chemistry Reference | m-Fluoroanisole(456-49-5) |
| Hazard Codes | F | | Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29093090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 3-Fluoroanisole Usage And Synthesis |
| Chemical Properties | clear colorless to straw yellow liquid | | Uses | 3-Fluoroanisole is used in the preparation of tertiary benzylic nitriles. | | Uses | 3-Fluoroanisole was used in the synthesis of 4-fluoro-5,6-dihydroxytryptamine. It was also used in the synthesis of 3-fluoro- and 5-fluoronoradrenaline. | | Synthesis Reference(s) | Tetrahedron, 52, p. 23, 1996 DOI: 10.1016/0040-4020(95)00867-8 |
| | 3-Fluoroanisole Preparation Products And Raw materials |
|