|
|
| | Ethyl 2-methylthiazole-4-carboxylate Basic information |
| | Ethyl 2-methylthiazole-4-carboxylate Chemical Properties |
| Melting point | 54-58 °C | | Boiling point | 242.1±13.0 °C(Predicted) | | density | 1.198±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 1.10±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H9NO2S/c1-3-10-7(9)6-4-11-5(2)8-6/h4H,3H2,1-2H3 | | InChIKey | QWWPUBQHZFHZSF-UHFFFAOYSA-N | | SMILES | S1C=C(C(OCC)=O)N=C1C | | CAS DataBase Reference | 6436-59-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29341000 |
| Provider | Language |
|
ALFA
| English |
| | Ethyl 2-methylthiazole-4-carboxylate Usage And Synthesis |
| Chemical Properties | light yellowto brownpowde | | Uses | Ethyl 2-methylthiazole-4-carboxylate is a reactant used in the synthesis of 2,4,5-trisubstituted thiazoles as antituberculosis agents effective against drug resistant tuberculosis. | | Synthesis | Ethyl 2-methylthiazole-4-carboxylate was synthesized from ethyl 3-bromopyruvate and thioacetamide in ethanol (EtOH) at 250 W power, 25 kHz frequency, flow rate controlled at 2 mL/min, and reaction time of 1.5 hours. | | References | [1] Journal of Organic Chemistry, 1997, vol. 62, # 12, p. 3804 - 3805 [2] Organic Letters, 2008, vol. 10, # 8, p. 1565 - 1568 [3] Journal of Organic Chemistry, 2001, vol. 66, # 19, p. 6410 - 6424 [4] Angewandte Chemie - International Edition, 2008, vol. 47, # 46, p. 8950 - 8953 [5] Patent: US2010/249404, 2010, A1. Location in patent: Page/Page column 11 |
| | Ethyl 2-methylthiazole-4-carboxylate Preparation Products And Raw materials |
|