- Procysteine
-
- $1.00 / 1ASSAYS
-
2020-01-01
- CAS:19771-63-2
- Min. Order: 1ASSAYS
- Purity: 95-99%
- Supply Ability: 1ton
|
| | Procysteine Basic information |
| Product Name: | Procysteine | | Synonyms: | (4R)-2-Oxothiazolidine-4-carboxylic acid;(4R)-2-Oxothiazolidine-4α-carboxylic acid;L-2-Thiazolidinone-4-carboxylic Acid,L-2-Oxothiazolidine-4-carboxylic Acid;(4R)-2-ketothiazolidine-4-carboxylic acid;L-Thiazolidin-2-one-4-carboxylic acid, OTC, Procysteine, OTZ;Oxothiazolidine carboxylate;4-Thiazolidinecarboxylicacid, 2-oxo-, (4R)-;L-2-Thiazolidinone-4-carboxylic Acid | | CAS: | 19771-63-2 | | MF: | C4H5NO3S | | MW: | 147.15 | | EINECS: | 200-154-8 | | Product Categories: | CARBOXYLICACID;whitening and anti-aging material and other functions in cosmetics | | Mol File: | 19771-63-2.mol |  |
| | Procysteine Chemical Properties |
| Melting point | 174 °C (dec.)(lit.) | | alpha | -60 º (c=1 in H2O) | | density | 1.582±0.06 g/cm3(Predicted) | | refractive index | -64 ° (C=1, H2O) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | pKa (22°): 3.32 | | form | Powder | | color | White to Off-white | | Water Solubility | Soluble in water | | Merck | 13,7019 | | BRN | 4179169 | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C4H5NO3S/c6-3(7)2-1-9-4(8)5-2/h2H,1H2,(H,5,8)(H,6,7)/t2-/m0/s1 | | InChIKey | BMLMGCPTLHPWPY-REOHCLBHSA-N | | SMILES | S1C[C@@H](C(O)=O)NC1=O | | CAS DataBase Reference | 19771-63-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | XJ5426650 | | HS Code | 2934.20.8000 | | Storage Class | 11 - Combustible Solids |
| | Procysteine Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | (R)-(-)-2-Oxothiazolidine-4-carboxylic Acid or Procysteine is a precursor to glutathione (GSH) which is an important antioxidant in plants, animals and fungi. | | Definition | ChEBI: (4R)-2-oxo-4-thiazolidinecarboxylic acid is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid. | | Biological Activity | 2-Oxothiazolidine-4-carboxylic acid augments glutathione and cysteine production. | | in vivo | Oxothiazolidinecarboxylic acid treatment attenuates plantaris atrophy, restored glutathione levels, and increased catalase, Cu/Zn-SOD1, and Mn-SOD2 mRNA expression, but did not reduce other markers of oxidant stress or levels of these catabolic factors[1]. | Animal Model: | Male Sprague-Dawley rats (200-250 g, n= 6-7 rats/group)[1]. | | Dosage: | 0.35% (w/v). | | Administration: | Added to their diets at a concentration of 0.35% (w/v) for the final 12 wk. | | Result: | Increased fiber CSAs compared to the non-supplemented, alcohol-fed group. |
|
| | Procysteine Preparation Products And Raw materials |
|